CHEMISTRY COMMUNITY

Kaitlin Ross 3E

The diagrams at the bottom of page 106 in the course reader show two different versions of 1,1-bromo-chloro-propene where one is E and the other is Z but the bromo and chloro groups are both on the left hand side of the diagram. How does switching the positions of the H and CH3 on the right hand sid...

Kaitlin Ross 3E

In the course reader, it says that bigger substituents have higher preference for equatorial position due to steric interactions. Do the steric interactions refer to hydrogen atoms coming off of substituents? What effect do these interactions have on the conformation?

Kaitlin Ross 3E

A general rule is that the only time a functional group is not given priority when numbering is if the functional group is an ether. All other functional groups should have the lowest possible number

Kaitlin Ross 3E

When the prefix iso- or neo- is present, it is used as part of the alphabetical ordering. On the other hand, when tert- or sec- comes before butyl, the butyl portion is used for alphabetical ordering.

Kaitlin Ross 3E

4-ethyl-2,2-dimethylhexane is correct because 2<5 so this way of naming the compound would give you an overall lower number than 3-ethyl-5,5-dimethylhexane even though 3<4.

Kaitlin Ross 3E

On the first Quiz 3 preparation in the workbook, question 8 asks you to circle the secondary carbons of the chain CH3CH2CH2C(CH3)(CH3CHCH3)CH3. How do we know which ones are the secondary carbon atoms?

Kaitlin Ross 3E

When calculating half-life, [A]=1/2[A]original so when you use the equation ln[A]= -kt + ln[A]original you can plug in .5[A]original for [A] to get ln(.5[A]original)= -kt + ln([A]original) which equals ln(.5[A]original/[A]original)=-kt. The [A]original cancels out leaving you with ln(.5)=-kt

Kaitlin Ross 3E

On page 96 of the course reader, the name given for the first example is 4-ethyl-2,2-dimethyl-hexane. Does the 4-ethyl-2 come first because it's in alphabetical order of substituents (since prefixes don't count) or because there's only one substituent attached to the 4th carbon in the chain compared...

Kaitlin Ross 3E

On page 72 in the course reader, for the example given its says to assume that A+B<-->C+D is an elementary 2nd order reaction. Should we always assume that chemical reactions with a forward and reverse process are 2nd order reactions?

Kaitlin Ross 3E

The rate of the reaction is equal to k([R]^n). The overall order is equal to n. For reactions with multiple reactants, (ex: A+B+C->D) the rate is equal to k([A]^n x [B]^m x [C]^l) and the overall order is equal to n+m+l.

Kaitlin Ross 3E

When finding the Gibbs free energy for parts a and b in problem 14.9, why are the units in J/mol instead of just J as seen in the example on page 52 of the course reader?

Kaitlin Ross 3E

The number of moles in the equation to calculate Gibbs free energy are the number of moles of electrons transferred, so when you write out the half reactions for the redox in reaction you will be able to see that in part a there were 2 moles of electrons transferred and in part b there were 6 moles....

Kaitlin Ross 3E

When it says E(cathode)-E(anode)=E(cell) for the reaction with copper and zinc, the E(Cu)=0.34 and the E(Zn)=-0.76. Does the reaction and value for Zinc get flipped or would the values be plugged into the equation so the value would be 0.34-(-0.76)=1.1V?

Kaitlin Ross 3E

The maximum potential difference between two electrodes signifies the electromotive force (emf) which is when the reaction has very little current flow and is reversible.

Kaitlin Ross 3E

On page 35 of the course reader, it states that biochemical reactions are often highly irreversible to speed up the process. Are there any instances in which a biochemical system would implement a reversible reaction/what would be an example?

Kaitlin Ross 3E

How would you calculate the work of expansion for an ideal gas that expands reversibly and isothermally causing a change in volume and a change in pressure?

Kaitlin Ross 3E

In an ideal system, q(sys)+q(surr)=0, meaning the heat given off by the reaction should equal the heat absorbed by the solution, canceling each other out to equal zero. To find q, the equation q=mC(delta)T can be used. When a reaction is exothermic, q will be negative and when a reaction is endother...

Kaitlin Ross 3E

Greater heat capacities don't necessarily depend on molar mass but on the molar complexity of a molecule. The more atoms that are present in a molecule, the more bond vibrations there are to absorb added energy.

Kaitlin Ross 3E

On page 17 of the course reader, it says that the temperature of a sample remains constant even though heat is being supplied for melting and boiling phase changes. I'm a little confused on how the temperature remains constant, what's the explanation behind that?

Kaitlin Ross 3E

The standard enthalpy of formation is the standard reaction enthalpy for the formation of 1 mole of a substance. Since there are 2 moles of the product in the reaction given in the course reader, you divide the standard reaction enthalpy by 2.

Kaitlin Ross 3E

An overview of indicators.

Kaitlin Ross 3E

The number of lone pairs present on each nitrogen atom can be determined by drawing out the Lewis structure for the ligand: Link to diagram of the Lewis structure: https://docs.google.com/document/d/1xxtNVzFpruKS51Ya52gijr0SXVZl5POTZda4wvuXi2M/edit?usp=sharing"onclick="window.open(this.href);return ...

Kaitlin Ross 3E

Smaller and more highly charged cations have a greater polarizing power while larger, less electronegative anions have a greater ability to become polarized.

Kaitlin Ross 3E

Do biradicals have the same damaging effect on DNA as radicals do? If not, how do biradicals react differently?

Kaitlin Ross 3E

How do we determine whether a compound has bridging bonds? For example, Al2Cl6

CHEMISTRY COMMUNITY

Search found 25 matches

E v. Z for 1,1-bromo-chloro-propene

Stability between axial and equatorial substituents

Re: ether priority

Re: exercises in introduction to organic chemistry book #16

Re: Introduction to Organic Chemistry P8

Secondary Carbons

Re: Half Life Equations

Naming with Multplie Substituents

Forward/Reverse reaction rates

Re: Determining Order of the Reaction

14.9- the units

Re: 14.9

Potential Difference CR pg. 49

Re: Importance of Emax

Biochemical systems- irreversible/reversible

Work of Expansion- reversible & isothermal

Re: Q's

Re: Heat Capacity and molar mass

Phase Changes- Melting/Boiling

Re: Standard Enthaly of Formation

Indicators Video

Re: Determining if ligands can be polydentate

Re: "Polarizing Power" Trends

Biradicals

Bridging Bonds