CHEMISTRY COMMUNITY

904564128

What exactly is residual entropy in comparison to entropy? What is different about the equations used to find each?

904564128

Could someone please remind me of the two separate equations used to solved for E (the ones that use log and ln)?

904564128

Name the compound CH3CH(CH3)CH(CH2CH3)C(CH3)3. You you please explain how one would draw this compound and why it is named 2,2,4-trimethyl 3-ethylpentane?

904564128

Then when is the equation ever used?

904564128

The first part of this question that requires you to calculate the cell potential does not make sense to me. The cell potential of the cathode (the half equation involving Br2) is positive, which makes sense, however the cell potential for the anode (Mn2+ equation) should have the sign of its given ...

904564128

Could you please explain how to find the degeneracy for a molecule such as BH2F? I'm still unclear on exactly what is done to find the value.

904564128

At the top of page 50 in the course reader, we are given an example of how to balance the half reactions to create a balanced redox reaction. I know Professor Lavelle said that if we know the half reactions are balanced, then the full one is, but I'm still confused since 2Fe (3+) + Cu \rightarrow Cu...

904564128

Question 9 asks to calculate delta G for the balanced reaction. I obtained the correct numerical value, but my answer is in units of kJ instead of kJ/mol as the workbook's answer states. I have noticed this happening in several other calculations, but I thought that the moles canceled when you multi...

904564128

Okay, I realize this is a very dumb and simple question but I seriously do not understand what the "m" stands for in things such as Cp,m and Cv,m.

904564128

Bond dissociation enthalpy is the energy needed to break one mole of the bond to give separated atoms - everything being in the gas state. Now consider methane, CH4. It contains four identical C-H bonds, and it seems reasonable that they should all have the same bond enthalpy. However, if you took m...

904564128

On page 18 of the course reader, the example of calculating delta H for nitrogen dioxide formation is given. I am confused about the use of Hess's Law for adding together the two equations. Where does NO go? Is it not used simply because the question is asking for the formation, which only includes ...

904564128

What happens to the pressure of H2O when the amount of Fe3O4 halves? Fe3O4 (s) + 4H2 (g) <--> 3Fe (s) + 4H2O (g)

904564128

The question asks: for the reaction at equilibrium, HCl + I2 <--> HI + Cl2, how will an increase in the pressure (by decreasing the volume) effect the concentration of Cl2? I found this question a little confusing because in the course reader (p. 129), it says that if the pressure double, the concen...

904564128

I feel like to know whether a salt is acidic or basic, you really just have to see if it includes one of 3 cations (Li, K, Na) or one of 3 anions (Cl, Br, I) and recognize that these will not affect pH, so the other half of the molecule must be the definer of the salt. Is this an oversimplification ...

904564128

I just wanted to double check that I was understanding how to find the oxidation number for an element correctly. So basically you add up all of the charges of the anions and then just give the metal the opposite charge to ensure that the entire compound has a charge of 0 (or whatever the overall ch...

904564128

I'm still confused how I could calculate the equilibrium constant when a reaction includes only solids and liquids. The course reader states the solids and liquids are not included in the equilibrium constant, so then does that just mean that no constant exists for that particular reaction? If so, t...

904564128

I'm still a little confused why the sigma Pz orbital has a higher energy than the pi Px and pi Py orbitals when an element has an atomic number less than 8. Also, which type of molecular orbital diagram would I draw for a compound such as CCl4?

904564128

If hybridization occurs with bonding and the overlapping of orbitals, then when is a molecule ever not hybridized, since all molecules have some type of bonding?

904564128

Since many Lewis structures have a more stable and less stable option, does that mean for every Lewis structure we draw, we should always be checking if there is a more stable option? Is there any sort of way to quickly decide if a molecule will have multiple options by just looking at the formula?

904564128

I have some confusion about the concept of multiple orbitals existing around one atom. If an atom has a d-orbital, does that mean that it also includes the shapes of the s and p orbitals? If so, do these orbitals all lie on top of each other in the given energy level? Or are they spaced out in some ...

904564128

Momentum is also equal to the product of energy and velocity. Since a photon has energy and velocity, it can therefore have momentum, even though it does not have a mass.

CHEMISTRY COMMUNITY

Search found 21 matches

Residual Entropy

Equation for E

Quiz 3 Preparation #2

Re: Midterm 2013 #7

Midterm 2013 #7

W for BH2F

Course Reader Balance Example

Quiz 1 Preparation, Winter 2014, #9 and #12

Cp,m

Re: Bond Enthalpies vs. Mean Bond Enthalpy

Nitrogen Dioxide Formation

Changing amount of a Solid

Workbook Quiz 3 #10

Identification

Oxidation Number

Solids and Liquids Chemical Equilibrium

Molecular Orbitals

Hybridization

Lewis Structure Stability

Multiple Orbitals

Re: Course Reader statement